For research use only. Not for therapeutic Use.
LCS3（Cat No.:I043380）is an investigational small molecule compound being studied for its potential therapeutic applications in cancer treatment. It acts as a selective inhibitor of specific enzymes or kinases involved in tumor growth, survival, and metastasis. By targeting these key molecular pathways, LCS3 aims to block the progression of cancer cells, potentially enhancing the effectiveness of other cancer therapies. It is being evaluated in preclinical and clinical trials for its efficacy in treating various cancers, particularly those resistant to conventional treatments, with ongoing research focusing on its safety and therapeutic potential.
| CAS Number | 109844-92-0 |
| Synonyms | N-(4-chlorophenyl)-5-nitrofuran-2-carboxamide |
| Molecular Formula | C11H7ClN2O4 |
| Purity | ≥95% |
| IUPAC Name | N-(4-chlorophenyl)-5-nitrofuran-2-carboxamide |
| InChI | InChI=1S/C11H7ClN2O4/c12-7-1-3-8(4-2-7)13-11(15)9-5-6-10(18-9)14(16)17/h1-6H,(H,13,15) |
| InChIKey | JDBZJNUHQINERI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C2=CC=C(O2)[N+](=O)[O-])Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
