For research use only. Not for therapeutic Use.
LDN-209929 2HCl is a potent and selective haspin kinase inhibitor.
| Catalog Number | I030602 |
| CAS Number | 1233355-57-1 |
| Synonyms | LDN-209929 2HCl; LDN 209929 2HCl; LDN209929 2HCl; LDN-209929 dihydrochloride; LDN 209929 dihydrochloride; LDN209929 dihydrochloride; |
| Molecular Formula | C17H19Cl3N2OS |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 3-[(2-Chloro-7-methoxy-9-acridinyl)thio]-1-propanamine dihydrochloride |
| InChI | InChI=1S/C17H17ClN2OS.2ClH/c1-21-12-4-6-16-14(10-12)17(22-8-2-7-19)13-9-11(18)3-5-15(13)20-16;;/h3-6,9-10H,2,7-8,19H2,1H3;2*1H |
| InChIKey | WOCCOXNODBCCGK-UHFFFAOYSA-N |
| SMILES | NCCCSC1=C(C=C(Cl)C=C2)C2=NC3=CC=C(OC)C=C31.[H]Cl.[H]Cl |
