For research use only. Not for therapeutic Use.
LDN-211904 oxalate（Cat No.:I011777）is a small-molecule inhibitor that targets a specific protein involved in cellular signaling pathways. It has shown promise in preclinical studies as a potential therapeutic for various diseases, including cancer and inflammatory disorders. By inhibiting this protein, LDN-211904 oxalate modulates cellular functions like growth, apoptosis, and immune response, which can be crucial for disease progression. The oxalate salt form ensures better solubility and bioavailability, enhancing its effectiveness in laboratory research and potential clinical applications. Further studies are needed to explore its full therapeutic potential.
| CAS Number | 1198408-78-4 |
| Synonyms | N-(2-chlorophenyl)-6-piperidin-4-ylimidazo[1,2-a]pyridine-3-carboxamide;oxalic acid |
| Molecular Formula | C21H21ClN4O5 |
| Purity | ≥95% |
| IUPAC Name | N-(2-chlorophenyl)-6-piperidin-4-ylimidazo[1,2-a]pyridine-3-carboxamide;oxalic acid |
| InChI | InChI=1S/C19H19ClN4O.C2H2O4/c20-15-3-1-2-4-16(15)23-19(25)17-11-22-18-6-5-14(12-24(17)18)13-7-9-21-10-8-13;3-1(4)2(5)6/h1-6,11-13,21H,7-10H2,(H,23,25);(H,3,4)(H,5,6) |
| InChIKey | ODBJGLKPAQMCJA-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CN3C(=NC=C3C(=O)NC4=CC=CC=C4Cl)C=C2.C(=O)(C(=O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
