For research use only. Not for therapeutic Use.
LDN193189（Cat No.:I000315）is a small molecule inhibitor that specifically targets the activin receptor-like kinase 2 (ALK2), a key receptor involved in the bone morphogenetic protein (BMP) signaling pathway. This pathway plays a critical role in regulating bone formation, cell differentiation, and tissue development. LDN193189 is primarily studied for its potential in treating diseases related to abnormal BMP signaling, such as fibrodysplasia ossificans progressiva (FOP) and certain cancers. By inhibiting ALK2, LDN193189 may help regulate abnormal bone growth and tissue calcification, offering therapeutic potential for these conditions. Further clinical studies are required.
| Catalog Number | I000315 |
| CAS Number | 1062368-24-4 |
| Synonyms | 4-[6-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]quinoline |
| Molecular Formula | C25H22N6 |
| Purity | ≥95% |
| Target | TGF-β Receptor |
| Solubility | DMSO: ＜ 4.1 mg/mL |
| Storage | 3 years -20C powder |
| IC50 | 5 nM/30 nM (ALK2/ALK3) [1] |
| IUPAC Name | 4-[6-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]quinoline |
| InChI | InChI=1S/C25H22N6/c1-2-4-24-22(3-1)21(9-10-27-24)23-16-29-31-17-19(15-28-25(23)31)18-5-7-20(8-6-18)30-13-11-26-12-14-30/h1-10,15-17,26H,11-14H2 |
| InChIKey | CDOVNWNANFFLFJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)C3=CN4C(=C(C=N4)C5=CC=NC6=CC=CC=C56)N=C3 |
