For research use only. Not for therapeutic Use.
Lead nitrite (Cat No.: M058626) is an inorganic compound used primarily in chemical synthesis and industrial applications. Known for its role as a nitrating agent, it is essential in the production of various chemicals, including dyes and pigments. This compound’s high reactivity and purity make it valuable in research and manufacturing processes. Lead nitrite is also utilized in explosives and pyrotechnics for its oxidizing properties. Its reliability ensures consistent results, making it a crucial component in advanced chemical and industrial applications.
CAS Number | 13826-65-8 |
Molecular Formula | N2O4Pb |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | lead(2+);dinitrite |
InChI | InChI=1S/2HNO2.Pb/c2*2-1-3;/h2*(H,2,3);/q;;+2/p-2 |
InChIKey | VVOUQFXJSCDIAO-UHFFFAOYSA-L |
SMILES | N(=O)[O-].N(=O)[O-].[Pb+2] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |