For research use only. Not for therapeutic Use.
Lecanoric acid is a naturally occurring phenolic compound found in various lichen species. It is a type of depside, a class of secondary metabolites produced by lichens, and is known for its potential biological activities, including antioxidant, antimicrobial, and anti-inflammatory properties. Lecanoric acid has been studied for its role in lichen biology and its potential therapeutic applications. Its presence in lichens also makes it a useful chemical marker for identifying and classifying different lichen species in ecological and taxonomic studies.
CAS Number | 480-56-8 |
Synonyms | NSC 249981 |
Molecular Formula | C16H14O7 |
Purity | ≥95% |
Target | Disease Research Fields |
Storage | -20°C |
IUPAC Name | 4-(2,4-dihydroxy-6-methylbenzoyl)oxy-2-hydroxy-6-methylbenzoic acid |
InChI | InChI=1S/C16H14O7/c1-7-3-9(17)5-11(18)14(7)16(22)23-10-4-8(2)13(15(20)21)12(19)6-10/h3-6,17-19H,1-2H3,(H,20,21) |
InChIKey | HEMSJKZDHNSSEW-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=C1C(=O)OC2=CC(=C(C(=C2)C)C(=O)O)O)O)O |