For research use only. Not for therapeutic Use.
LEI110（Cat No.:I043729）is a selective small molecule inhibitor designed to target specific enzymes or receptors involved in cellular processes such as cell growth, survival, and immune response. It works by modulating key signaling pathways that are crucial for tumor progression and immune regulation. LEI110 has shown promise in preclinical studies for its ability to inhibit cancer cell proliferation and enhance the immune response against tumors. Its high specificity and potency make it a valuable tool for cancer research, offering potential for developing targeted therapies and improving treatment outcomes in oncology.
| CAS Number | 2313525-90-3 |
| Synonyms | 2-oxo-5-phenyl-N-[2-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenyl]ethyl]pentanamide |
| Molecular Formula | C25H23F3N2O3 |
| Purity | ≥95% |
| IUPAC Name | 2-oxo-5-phenyl-N-[2-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenyl]ethyl]pentanamide |
| InChI | InChI=1S/C25H23F3N2O3/c26-25(27,28)20-11-14-23(30-17-20)33-21-12-9-19(10-13-21)15-16-29-24(32)22(31)8-4-7-18-5-2-1-3-6-18/h1-3,5-6,9-14,17H,4,7-8,15-16H2,(H,29,32) |
| InChIKey | DZHZISUSQMPBJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCC(=O)C(=O)NCCC2=CC=C(C=C2)OC3=NC=C(C=C3)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
