For research use only. Not for therapeutic Use.
Lenalidomide-OH（Cat No.:I016889） is an analog of the cereblon (CRBN) ligand lenalidomide, designed for the recruitment of CRBN protein in the context of proteolysis-targeting chimera (PROTAC) technology. It serves as a connecting point between the ligand for the target protein and CRBN. Through a linker, lenalidomide-OH can be conjugated to the ligand, forming PROTACs such as the BTK degrader SJF620 (HY-133137). This strategy allows for the targeted degradation of specific proteins of interest by utilizing the E3 ubiquitin ligase activity of CRBN and the ubiquitin-proteasome system.
| Catalog Number | I016889 |
| CAS Number | 1416990-08-3 |
| Molecular Formula | C₁₃H₁₂N₂O₄ |
| Purity | ≥95% |
| Target | Ligands for E3 Ligase |
| IUPAC Name | 3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChI | InChI=1S/C13H12N2O4/c16-8-1-2-9-7(5-8)6-15(13(9)19)10-3-4-11(17)14-12(10)18/h1-2,5,10,16H,3-4,6H2,(H,14,17,18) |
| InChIKey | JJUMFQGCQAUIFH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3)O |
| Reference | [1]. Jaime-Figueroa S, et al. Design, synthesis and biological evaluation of Proteolysis Targeting Chimeras (PROTACs) as a BTK degraders with improved pharmacokinetic properties. 2020 Feb 1;30(3):126877. |
