For research use only. Not for therapeutic Use.
Leonurine hydrochloride(CAT: I002837), also known as SCM-198, is a natural compound derived from the Chinese herb Leonurus japonicas. It possesses various pharmacological activities and has been studied for its potential therapeutic applications. Leonurine hydrochloride exhibits antioxidant properties and can scavenge free radicals, thereby protecting cells from oxidative stress. It also demonstrates anti-inflammatory effects by inhibiting the production of pro-inflammatory cytokines. Additionally, leonurine hydrochloride has been investigated for its cardiovascular benefits, including its ability to regulate blood pressure, improve cardiac function, and protect against ischemic heart injury. Furthermore, it shows neuroprotective effects by reducing neuronal damage and inflammation in various neurodegenerative diseases. Leonurine hydrochloride holds promise as a natural compound with multiple therapeutic potentials, although further research is needed to fully understand its mechanisms of action and clinical applications.
Catalog Number | I002837 |
CAS Number | 24735-18-0 |
Molecular Formula | C14H22ClN3O5 |
Purity | ≥95% |
Target | Autophagy |
Solubility | DMSO: ≥ 31 mg/mL |
Storage | Store at -20°C |
IUPAC Name | 4-(diaminomethylideneamino)butyl 4-hydroxy-3,5-dimethoxybenzoate;hydrochloride |
InChI | 1S/C14H21N3O5.ClH/c1-20-10-7-9(8-11(21-2)12(10)18)13(19)22-6-4-3-5-17-14(15)16;/h7-8,18H,3-6H2,1-2H3,(H4,15,16,17);1H |
InChIKey | GHVZIMAVDJZQGP-UHFFFAOYSA-N |
SMILES | COC1=CC(=CC(=C1O)OC)C(=O)OCCCCN=C(N)N.Cl |