For research use only. Not for therapeutic Use.
Leu-phalloidin is a phallotoxin.
| Catalog Number | I030689 |
| CAS Number | 65986-99-4 |
| Synonyms | Leu-phalloidin; |
| Molecular Formula | C35H48N8O9S |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | Cyclic(L-Alanyl-D-threonyl-L-cysteinyl-cis-4-hydroxy-L-prolyl-L-alanyl-2-mercapto-L-tryptophyl-4-methyl-L-norvalyl) cyclic (3-6)-sulfide |
| InChI | 1S/C35H48N8O9S/c1-15(2)10-23-30(48)36-17(4)29(47)42-27(18(5)44)33(51)40-25-14-53-34-21(20-8-6-7-9-22(20)41-34)12-24(31(49)39-23)38-28(46)16(3)37-32(50)26-11-19(45)13-43(26)35(25)52/h6-9,15-19,23-27,41,44-45H,10-14H2,1-5H3,(H,36,48)(H,37,50)(H,38,46)(H,39,49)(H,40,51)(H,42,47) |
| InChIKey | DJCBRMHVPLXXAY-UHFFFAOYSA-N |
| SMILES | CC1C(NC2Cc3c(SCC(NC(C(C(O)C)NC(C(C)NC(C(CC(C)C)NC2=O)=O)=O)=O)C(N4CC(O)CC4C(N1)=O)=O)[nH]c5c3cccc5)=O |
