For research use only. Not for therapeutic Use.
Leucettine L41 (Cat.No:I002188) is a natural compound derived from marine sponges. It exhibits potent inhibitory activity against cyclin-dependent kinases (CDKs), enzymes involved in cell cycle regulation. Leucettine L41 has shown potential as an anti-cancer agent, as it can induce cell cycle arrest and apoptosis in cancer cells. Further research is underway to explore its therapeutic applications.
| Catalog Number | I002188 |
| CAS Number | 1112978-84-3 |
| Synonyms | (5Z)-5-(1,3-Benzodioxol-5-yl)methylene-2-phenylamino-3,5-dihydro-4H-imidazol-4one |
| Molecular Formula | C17H13N3O3 |
| Purity | ≥95% |
| Target | Protein Tyrosine Kinase/RTK |
| Solubility | DMSO or EtOH |
| Storage | RT |
| IUPAC Name | (5Z)-2-anilino-5-(1,3-benzodioxol-5-ylmethylidene)-1H-imidazol-4-one |
| InChI | InChI=1S/C17H13N3O3/c21-16-13(8-11-6-7-14-15(9-11)23-10-22-14)19-17(20-16)18-12-4-2-1-3-5-12/h1-9H,10H2,(H2,18,19,20,21)/b13-8- |
| InChIKey | PGPHHJBZEGSUNE-JYRVWZFOSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C=C3C(=O)N=C(N3)NC4=CC=CC=C4 |
