For research use only. Not for therapeutic Use.
(+)-Leucocyanidin(CAT: I040802) is a colorless flavonoid belonging to the leucoanthocyanidin subclass, characterized by its chemical formula C₁₅H₁₄O₇ and a molar mass of 306.26 g/mol. It serves as a precursor in the biosynthesis of anthocyanidins and catechins, compounds integral to plant pigmentation and defense mechanisms. This compound is naturally present in various plants, including Aesculus hippocastanum (horse chestnut), Anacardium occidentale (cashew), and Vitis vinifera (grapevine). Due to its role in forming proanthocyanidins, (+)-Leucocyanidin is of interest in research focused on plant biochemistry and the development of antioxidant-rich products.
| CAS Number | 69256-15-1 |
| Synonyms | (2R,3S,4R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,5,7-tetrol |
| Molecular Formula | C15H14O7 |
| Purity | ≥95% |
| IUPAC Name | (2R,3S,4R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,5,7-tetrol |
| InChI | InChI=1S/C15H14O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,13-21H/t13-,14+,15-/m1/s1 |
| InChIKey | SBZWTSHAFILOTE-QLFBSQMISA-N |
| SMILES | C1=CC(=C(C=C1[C@@H]2[C@H]([C@@H](C3=C(C=C(C=C3O2)O)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
