For research use only. Not for therapeutic Use.
Potent lipid inflammatory mediator derived from the 5-lipoxygenase pathway of arachidonic acid metabolism. Binds to BLT<sub>1</sub> and BLT<sub>2</sub> receptors and acts as a potent chemotactic agent and activator of leukocytes. Also displays antiviral activity towards DNA viruses and retroviruses.
| Catalog Number | I010536 |
| CAS Number | 71160-24-2 |
| Synonyms | Alternative Names: LTB4, 5,12-DiHETE |
| Molecular Formula | C20H32O4 |
| Purity | ≥95% |
| Target | Leukotriene Receptor |
| Solubility | Soluble in ethanol (supplied pre-dissolved in anhydrous ethanol, 50�g/ml) |
| Storage | Store at -20C |
| IUPAC Name | (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoic acid |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h6-11,14-15,18-19,21-22H,2-5,12-13,16-17H2,1H3,(H,23,24)/b8-7+,9-6-,14-10+,15-11-/t18-,19-/m1/s1 |
| InChIKey | VNYSSYRCGWBHLG-AMOLWHMGSA-N |
| SMILES | CCCCCC=CCC(C=CC=CC=CC(CCCC(=O)O)O)O |
