For research use only. Not for therapeutic Use.
Levovirin(Cat No.:R058904)is an antiviral nucleoside analog, structurally related to ribavirin, that has shown potential in the treatment of viral infections, particularly hepatitis C. It functions by inhibiting viral RNA synthesis, thereby reducing viral replication. Levovirin is noted for its reduced toxicity compared to ribavirin, making it a promising candidate in antiviral therapies with fewer side effects. Its unique mechanism of action and favorable safety profile make it an important compound in ongoing research aimed at developing effective treatments for chronic viral infections, particularly in combination therapies.
CAS Number | 206269-27-4 |
Synonyms | 1-β-L-Ribofuranosyl-1H-1,2,4-triazole-3-carboxamide; ICN 17261; L-Ribavirin; |
Molecular Formula | C8H12N4O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
InChI | InChI=1S/C8H12N4O5/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8/h2-5,8,13-15H,1H2,(H2,9,16)/t3-,4-,5-,8-/m0/s1 |
InChIKey | IWUCXVSUMQZMFG-RGDLXGNYSA-N |
SMILES | C1=NC(=NN1C2C(C(C(O2)CO)O)O)C(=O)N |