For research use only. Not for therapeutic Use.
Levulinic acid-d5（Cat No.:R060978）is a deuterated form of levulinic acid, where five hydrogen atoms are replaced by deuterium, a stable isotope of hydrogen. This modification makes it highly valuable in nuclear magnetic resonance (NMR) spectroscopy, where deuterium reduces background interference from protons, allowing for clearer and more precise data. Levulinic acid-d5 is used in research to study molecular structures, chemical reactions, and kinetics in organic chemistry and pharmaceutical development. Its deuteration also aids in investigations of metabolic pathways and the behavior of chemical compounds in various industrial applications.
| CAS Number | 1206185-52-5 |
| Synonyms | 3,3,5,5,5-pentadeuterio-4-oxopentanoic acid |
| Molecular Formula | C5H3D5O3 |
| Purity | ≥95% |
| IUPAC Name | 3,3,5,5,5-pentadeuterio-4-oxopentanoic acid |
| InChI | InChI=1S/C5H8O3/c1-4(6)2-3-5(7)8/h2-3H2,1H3,(H,7,8)/i1D3,2D2 |
| InChIKey | JOOXCMJARBKPKM-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])CC(=O)O |
