For research use only. Not for therapeutic Use.
Levulinic acid(Cat No.:R040602), is a naturally occurring organic compound derived from biomass, particularly carbohydrates like glucose and fructose. It is a white crystalline solid at room temperature and is known for its versatility in various applications. Levulinic acid serves as a platform chemical for the production of a wide range of value-added chemicals and materials, including solvents, plasticizers, pharmaceuticals, and biofuels.
Catalog Number | R040602 |
CAS Number | 123-76-2 |
Synonyms | 3-Acetylpropionic Acid; 3-Oxobutanecarboxylic Acid; 4-Ketovaleric Acid; 4-Oxopentanoic Acid; 4-Oxovaleric Acid; Laevulinic Acid; Levulic Acid; NSC 3716; β-Acetylpropionic Acid; γ-Ketovaleric Acid |
Molecular Formula | C5H8O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 4-oxopentanoic acid |
InChI | InChI=1S/C5H8O3/c1-4(6)2-3-5(7)8/h2-3H2,1H3,(H,7,8) |
InChIKey | JOOXCMJARBKPKM-UHFFFAOYSA-N |
SMILES | CC(=O)CCC(=O)O |