For research use only. Not for therapeutic Use.
Lewis X Trisaccharide(Cat No.:R000163)is a key carbohydrate structure involved in cell-cell interactions, particularly in the immune system. This trisaccharide, composed of fucose and galactose residues, is found on glycoproteins and glycolipids and plays a crucial role in leukocyte trafficking and adhesion to endothelial cells. Its expression is associated with inflammatory processes and cancer metastasis, where it facilitates the binding of immune cells to blood vessels. Lewis X Trisaccharide is also a target for therapeutic interventions aimed at modulating immune responses or inhibiting tumor spread in cancer research.
CAS Number | 71208-06-5 |
Synonyms | 2-Acetamido-2-deoxy-3-O-(α-L-fucopyranosyl)-4-O-(b-D-galactopyranosyl)-D-?glucopyranose, Gal1-b-4[Fuc1-α-3]GlcNAc |
Molecular Formula | C20H35NO15 |
Purity | ≥95% |
Target | Parasite |
Storage | Desiccate at -20C |
IUPAC Name | N-[(2R,3R,4R,5R)-5,6-dihydroxy-1-oxo-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyhexan-2-yl]acetamide |
InChI | InChI=1S/C20H35NO15/c1-6-11(27)13(29)15(31)19(33-6)35-17(8(3-22)21-7(2)25)18(9(26)4-23)36-20-16(32)14(30)12(28)10(5-24)34-20/h3,6,8-20,23-24,26-32H,4-5H2,1-2H3,(H,21,25)/t6-,8-,9+,10+,11+,12-,13+,14-,15-,16+,17+,18+,19-,20-/m0/s1 |
InChIKey | ZAFUNKXZZPSTLA-MBKDEEHCSA-N |
SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)O[C@H]([C@H](C=O)NC(=O)C)[C@@H]([C@@H](CO)O)O[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |