For research use only. Not for therapeutic Use.
Lexibulin（Cat No.:I005466）is a potent vascular-disrupting agent (VDA) used in cancer research for its ability to target and disrupt tumor blood vessels. By destabilizing microtubules, it interferes with the cytoskeleton, impairing the function of endothelial cells in tumor vasculature, leading to rapid tumor necrosis. Lexibulin’s selective targeting of abnormal vasculature makes it an effective candidate in studies exploring novel anti-cancer therapies. Its unique mechanism helps enhance tumor sensitivity to traditional chemotherapy, offering potential for improved treatment outcomes in various solid tumors.
| Catalog Number | I005466 |
| CAS Number | 917111-44-5 |
| Synonyms | 1-ethyl-3-[2-methoxy-4-[5-methyl-4-[[(1S)-1-pyridin-3-ylbutyl]amino]pyrimidin-2-yl]phenyl]urea |
| Molecular Formula | C24H30N6O2 |
| Purity | ≥95% |
| Target | Microtubule/Tubulin |
| Solubility | DMSO 85 mg/ml; Water <1 mg/ml |
| Storage | 3 years -20C powder |
| IC50 | 10-100 nM(cell assay) [1] |
| IUPAC Name | 1-ethyl-3-[2-methoxy-4-[5-methyl-4-[[(1S)-1-pyridin-3-ylbutyl]amino]pyrimidin-2-yl]phenyl]urea |
| InChI | InChI=1S/C24H30N6O2/c1-5-8-19(18-9-7-12-25-15-18)28-22-16(3)14-27-23(30-22)17-10-11-20(21(13-17)32-4)29-24(31)26-6-2/h7,9-15,19H,5-6,8H2,1-4H3,(H2,26,29,31)(H,27,28,30)/t19-/m0/s1 |
| InChIKey | MTJHLONVHHPNSI-IBGZPJMESA-N |
| SMILES | CCC[C@@H](C1=CN=CC=C1)NC2=NC(=NC=C2C)C3=CC(=C(C=C3)NC(=O)NCC)OC |
| Reference | <p style=/line-height:25px/> |
