For research use only. Not for therapeutic Use.
LGD-3303(Cat No.:I011845)is a selective androgen receptor modulator (SARM) under investigation for its potential use in treating conditions like muscle wasting, osteoporosis, and sarcopenia. It works by binding to androgen receptors in muscle and bone tissues, mimicking the effects of anabolic steroids, such as promoting muscle growth and bone density, without the adverse side effects typically associated with traditional anabolic steroids. LGD-3303 is being studied for its ability to improve physical performance, strength, and overall quality of life in patients with degenerative conditions, though it is still in early clinical stages.
CAS Number | 917891-35-1 |
Synonyms | LGD 3303; 9-Chloro-2-ethyl-3,6-dihydro-1-methyl-3-(2,2,2-trifluoroethyl)-7H-pyrrolo[3,2-f]quinolin-7-one; |
Molecular Formula | C16H14ClF3N2O |
Purity | ≥95% |
Target | Androgen receptor |
Storage | RT |
IUPAC Name | 9-chloro-2-ethyl-1-methyl-3-(2,2,2-trifluoroethyl)-6H-pyrrolo[3,2-f]quinolin-7-one |
InChI | InChI=1S/C16H14ClF3N2O/c1-3-11-8(2)14-12(22(11)7-16(18,19)20)5-4-10-15(14)9(17)6-13(23)21-10/h4-6H,3,7H2,1-2H3,(H,21,23) |
InChIKey | OMXGOGXEWUCLFI-UHFFFAOYSA-N |
SMILES | CCC1=C(C2=C(N1CC(F)(F)F)C=CC3=C2C(=CC(=O)N3)Cl)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |