LGD-4033(Cat No.:I000595), also known as Ligandrol, is a selective androgen receptor modulator (SARM) developed to treat muscle wasting and osteoporosis. It binds to androgen receptors with high affinity and selectivity, promoting muscle growth and bone density without the adverse effects associated with traditional anabolic steroids. LGD-4033 has shown promise in clinical trials for increasing lean muscle mass and improving physical performance. Its potential benefits in muscle-wasting conditions and age-related muscle loss make it a valuable candidate for therapeutic use in sports medicine and geriatric care.
| Catalog Number | I000595 |
| CAS Number | 1165910-22-4 |
| Synonyms | LGD-4033; LGD4033;LGD 4033;4-[(2R)-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]-1-pyrrolidinyl]-2-(trifluoromethyl)-benzonitrile |
| Molecular Formula | C14H12F6N2O |
| Purity | ≥95% |
| Target | androgen receptor (AR) |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IC50 | 1 nM (Ki, for androgen receptor) |
| IUPAC Name | 4-[(2R)-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| InChI | InChI=1S/C14H12F6N2O/c15-13(16,17)10-6-9(4-3-8(10)7-21)22-5-1-2-11(22)12(23)14(18,19)20/h3-4,6,11-12,23H,1-2,5H2/t11-,12-/m1/s1 |
| InChIKey | OPSIVAKKLQRWKC-VXGBXAGGSA-N |
| SMILES | C1CC(N(C1)C2=CC(=C(C=C2)C#N)C(F)(F)F)C(C(F)(F)F)O |
