For research use only. Not for therapeutic Use.
LH21（Cat No.:I011521）is a small molecule inhibitor designed to target specific proteins involved in key cellular processes such as tumor growth, survival, and immune regulation. It has shown promising activity in preclinical studies, particularly in modulating pathways associated with cancer progression and immune system evasion. LH21 works by selectively interfering with signaling pathways critical for cell cycle regulation and apoptosis, leading to inhibited tumor growth. Its high specificity and potent action make it a valuable tool in cancer research, offering potential for the development of targeted therapies for various cancer types.
| CAS Number | 611207-11-5 |
| Synonyms | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-hexyl-1,2,4-triazole |
| Molecular Formula | C20H20Cl3N3 |
| Purity | ≥95% |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-hexyl-1,2,4-triazole |
| InChI | InChI=1S/C20H20Cl3N3/c1-2-3-4-5-6-19-24-20(14-7-9-15(21)10-8-14)26(25-19)18-12-11-16(22)13-17(18)23/h7-13H,2-6H2,1H3 |
| InChIKey | USJFDADYVUDVAX-UHFFFAOYSA-N |
| SMILES | CCCCCCC1=NN(C(=N1)C2=CC=C(C=C2)Cl)C3=C(C=C(C=C3)Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
