For research use only. Not for therapeutic Use.
Licarbazepine-d3（Cat No.:S000266） is a deuterated form of licarbazepine, where three hydrogen atoms are replaced with deuterium, enhancing its molecular stability. This attribute makes it particularly valuable as an internal standard for analytical methods like mass spectrometry and NMR spectroscopy. Licarbazepine is an active metabolite of the anticonvulsant drug oxcarbazepine, used primarily to treat epilepsy by modulating voltage-gated sodium channels to stabilize hyperactive neurons.
| Catalog Number | S000266 |
| CAS Number | 1189917-36-9 |
| Molecular Formula | C15H11D3N2O2 |
| Purity | ≥95% |
| IUPAC Name | 5,6,6-trideuterio-5-hydroxybenzo[b][1]benzazepine-11-carboxamide |
| InChI | InChI=1S/C15H14N2O2/c16-15(19)17-12-7-3-1-5-10(12)9-14(18)11-6-2-4-8-13(11)17/h1-8,14,18H,9H2,(H2,16,19)/i9D2,14D |
| InChIKey | BMPDWHIDQYTSHX-BAVZAHHNSA-N |
| SMILES | C1C(C2=CC=CC=C2N(C3=CC=CC=C31)C(=O)N)O |
