For research use only. Not for therapeutic Use.
(±)-Licarin A (Cas No.:23518-30-1) is a natural neolignan compound derived from plants such as licorice. It possesses various pharmacological activities, including antioxidant, anti-inflammatory, antimicrobial, and anticancer properties. Licarin A has demonstrated hepatoprotective effects and shows potential for protecting liver health. It has been found to inhibit certain enzymes involved in inflammation and modulate signaling pathways related to cell growth and apoptosis. Licarin A holds promise as a natural compound with therapeutic potential, but further research is needed to fully understand its mechanisms, optimize dosage, and assess its clinical applications.
Catalog Number | R072586 |
CAS Number | 23518-30-1 |
Molecular Formula | C20H22O4 |
Purity | ≥95% |
Target | Parasite |
IUPAC Name | 2-methoxy-4-[(2S,3S)-7-methoxy-3-methyl-5-[(E)-prop-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]phenol |
InChI | InChI=1S/C20H22O4/c1-5-6-13-9-15-12(2)19(24-20(15)18(10-13)23-4)14-7-8-16(21)17(11-14)22-3/h5-12,19,21H,1-4H3/b6-5+/t12-,19-/m0/s1 |
InChIKey | ITDOFWOJEDZPCF-FNINDUDTSA-N |
SMILES | C/C=C/C1=CC2=C(C(=C1)OC)O[C@@H]([C@H]2C)C3=CC(=C(C=C3)O)OC |