For research use only. Not for therapeutic Use.
Licoflavone B（Cat No.:I018235）is a naturally occurring flavonoid isolated from licorice root, known for its potential antioxidant, anti-inflammatory, and anticancer properties. It works by scavenging free radicals and modulating inflammatory pathways, which may help protect cells from oxidative damage and reduce inflammation. Licoflavone B has garnered interest in cancer research for its ability to inhibit cell proliferation and promote apoptosis in cancer cells. Its broad bioactivity makes it a promising compound in the development of therapeutic agents aimed at managing chronic diseases, supporting immune health, and promoting overall cellular health.
| Catalog Number | I018235 |
| CAS Number | 91433-17-9 |
| Molecular Formula | C₂₅H₂₆O₄ |
| Purity | ≥95% |
| IUPAC Name | 7-hydroxy-2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-6-(3-methylbut-2-enyl)chromen-4-one |
| InChI | InChI=1S/C25H26O4/c1-15(2)5-7-17-11-19(9-10-21(17)26)24-14-23(28)20-12-18(8-6-16(3)4)22(27)13-25(20)29-24/h5-6,9-14,26-27H,7-8H2,1-4H3 |
| InChIKey | GLDVIKFETPAZNV-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=CC2=C(C=C1O)OC(=CC2=O)C3=CC(=C(C=C3)O)CC=C(C)C)C |
| Reference | [1]. Aleixo de Carvalho LS1, et al. Schistosomicidal activity and docking of Schistosoma mansoni ATPDase 1 with licoflavone B isolated from Glycyrrhiza inflata (Fabaceae). |
