For research use only. Not for therapeutic Use.
Licoflavonol is a naturally occurring flavonoid compound found in certain plants. Flavonoids like licoflavonol are known for their antioxidant, anti-inflammatory, and potential anticancer properties. These compounds play a role in protecting cells from oxidative stress and may contribute to the prevention of various chronic diseases. Licoflavonol, like other flavonoids, is also studied for its potential benefits in cardiovascular health, as well as its role in modulating cellular signaling pathways. It is of interest in both nutritional science and pharmacological research for its potential therapeutic applications.
CAS Number | 60197-60-6 |
Synonyms | 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-6-(3-methylbut-2-enyl)chromen-4-one |
Molecular Formula | C20H18O6 |
Purity | ≥95% |
InChI | InChI=1S/C20H18O6/c1-10(2)3-8-13-14(22)9-15-16(17(13)23)18(24)19(25)20(26-15)11-4-6-12(21)7-5-11/h3-7,9,21-23,25H,8H2,1-2H3 |
InChIKey | TVMHBSODLWMMMV-UHFFFAOYSA-N |
SMILES | CC(=CCC1=C(C2=C(C=C1O)OC(=C(C2=O)O)C3=CC=C(C=C3)O)O)C |