For research use only. Not for therapeutic Use.
Licoisoflavone B is a high-purity natural compound used in pharmaceutical and biochemical research. This isoflavone, derived from licorice root, is essential for studying its anti-inflammatory and antioxidant properties. Its precise composition ensures reliable and reproducible results, making it indispensable for drug development and natural product research. Ideal for experimental setups, Licoisoflavone B enhances research accuracy and efficacy in various scientific investigations.
| Catalog Number | R024236 |
| CAS Number | 66056-30-2 |
| Molecular Formula | C20H16O6 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| IUPAC Name | 5,7-dihydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one |
| InChI | InChI=1S/C20H16O6/c1-20(2)6-5-12-15(26-20)4-3-11(18(12)23)13-9-25-16-8-10(21)7-14(22)17(16)19(13)24/h3-9,21-23H,1-2H3 |
| InChIKey | KIZPADOTOCPASX-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC(=C2O)C3=COC4=CC(=CC(=C4C3=O)O)O)C |
