For research use only. Not for therapeutic Use.
Licoricidin (Cat.No:R024956) is a natural compound found in licorice root (Glycyrrhiza glabra). It exhibits various pharmacological properties, including antioxidant, anti-inflammatory, and antiviral activities. Licoricidin has been studied for its potential therapeutic effects in various diseases, such as cancer, neurodegenerative disorders, and viral infections. Further research is ongoing to explore its diverse medicinal applications.
| Catalog Number | R024956 |
| CAS Number | 30508-27-1 |
| Molecular Formula | C26H32O5 |
| Purity | ≥95% |
| Target | NF-κB |
| Storage | Store at -20°C |
| IUPAC Name | 4-[(3R)-7-hydroxy-5-methoxy-6-(3-methylbut-2-enyl)-3,4-dihydro-2H-chromen-3-yl]-2-(3-methylbut-2-enyl)benzene-1,3-diol |
| InChI | InChI=1S/C26H32O5/c1-15(2)6-8-19-22(27)11-10-18(25(19)29)17-12-21-24(31-14-17)13-23(28)20(26(21)30-5)9-7-16(3)4/h6-7,10-11,13,17,27-29H,8-9,12,14H2,1-5H3/t17-/m0/s1 |
| InChIKey | GBRZTUJCDFSIHM-KRWDZBQOSA-N |
| SMILES | CC(=CCC1=C(C=CC(=C1O)C2CC3=C(C(=C(C=C3OC2)O)CC=C(C)C)OC)O)C |
