For research use only. Not for therapeutic Use.
Licoricone (Cat No.:R017313) is a natural compound found in licorice root (Glycyrrhiza species), renowned for its potential health benefits. With antioxidant properties, it combats oxidative stress, shielding cells from damage. Licoricone also exhibits anti-inflammatory effects by modulating immune responses and inhibiting inflammatory mediators. Additionally, it holds promise in skin care due to its potential to inhibit tyrosinase, contributing to skin brightening. As research unfolds, licoricone’s applications may span dietary supplements, cosmetics, and pharmaceuticals, highlighting its significance in wellness, dermatology, and beyond.
Catalog Number | R017313 |
CAS Number | 51847-92-8 |
Molecular Formula | C22H22O6 |
Purity | ≥95% |
Target | Bacterial |
Storage | 3 years -20C powder |
IUPAC Name | 7-hydroxy-3-[6-hydroxy-2,4-dimethoxy-3-(3-methylbut-2-enyl)phenyl]chromen-4-one |
InChI | InChI=1S/C22H22O6/c1-12(2)5-7-15-18(26-3)10-17(24)20(22(15)27-4)16-11-28-19-9-13(23)6-8-14(19)21(16)25/h5-6,8-11,23-24H,7H2,1-4H3 |
InChIKey | GGWMNTNDTRKETA-UHFFFAOYSA-N |
SMILES | CC(=CCC1=C(C=C(C(=C1OC)C2=COC3=C(C2=O)C=CC(=C3)O)O)OC)C |