For research use only. Not for therapeutic Use.
Lidocaine（Cat No.:A000500）, is a local anesthetic and antiarrhythmic medication used for pain management and controlling irregular heart rhythms. It belongs to the class of drugs known as amide local anesthetics. Lidocaine works by blocking nerve signals in the body, leading to temporary loss of sensation in a specific area, making it valuable for medical procedures, dental work, and minor surgeries. It is also used to treat ventricular arrhythmias, a type of abnormal heart rhythm. Lidocaine is available in various forms, including creams, gels, injections, and patches, and is a widely used and well-tolerated anesthetic agent in medical practice.
| Catalog Number | A000500 |
| CAS Number | 137-58-6 |
| Synonyms | Alphacaine |
| Molecular Formula | C14H22N2O |
| Purity | ≥95% |
| Target | Histamine Receptor |
| Solubility | >11.7mg/mL in DMSO |
| Storage | Store at RT |
| IUPAC Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide |
| InChI | InChI=1S/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17) |
| InChIKey | NNJVILVZKWQKPM-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)NC1=C(C=CC=C1C)C |
