For research use only. Not for therapeutic Use.
Lidocaine hydrochloride（Cat No.:A000016） is a widely used local anesthetic and antiarrhythmic drug. As the hydrochloride salt, it is more soluble in water, facilitating its administration for various medical purposes. Lidocaine works by blocking sodium channels in nerve cells, preventing the propagation of electrical signals that convey sensation, thus achieving local anesthesia. It is commonly applied topically, injected, or used in dental procedures to numb specific areas. Additionally, lidocaine has antiarrhythmic properties, useful in treating certain types of cardiac arrhythmias by stabilizing the cardiac membrane and restoring regular heart rhythm.
| Catalog Number | A000016 |
| CAS Number | 73-78-9 |
| Synonyms | Lidocaine HCL, Lidothesin, Lignocaine hydrochloride, Xyloneural |
| Molecular Formula | C14H22N2O.HCl |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;hydrochloride |
| InChI | InChI=1S/C14H22N2O.ClH/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4;/h7-9H,5-6,10H2,1-4H3,(H,15,17);1H |
| InChIKey | IYBQHJMYDGVZRY-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)NC1=C(C=CC=C1C)C.Cl |
