For research use only. Not for therapeutic Use.
Liensinine(CAT: R072589) is a natural alkaloid isolated from the lotus plant (Nelumbo nucifera). Its mode of action involves being a bioactive compound with potential pharmacological activities. Pharmacologically, liensinine has been studied for various effects, including antioxidant, anti-inflammatory, and cardiovascular properties. It has shown promise in preclinical studies, demonstrating its potential as a natural antioxidant and its ability to modulate inflammatory responses. Additionally, liensinine has been investigated for its potential cardiovascular benefits, such as its effects on blood pressure and cardiac function.
| Catalog Number | R072589 |
| CAS Number | 2586-96-1 |
| Molecular Formula | C37H42N2O6 |
| Purity | ≥95% |
| Target | Apoptosis |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]-2-[[(1R)-1-[(4-hydroxyphenyl)methyl]-6-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]phenol |
| InChI | InChI=1S/C37H42N2O6/c1-38-14-13-26-20-35(43-4)37(22-29(26)30(38)16-23-6-9-27(40)10-7-23)45-33-18-24(8-11-32(33)41)17-31-28-21-36(44-5)34(42-3)19-25(28)12-15-39(31)2/h6-11,18-22,30-31,40-41H,12-17H2,1-5H3/t30-,31-/m1/s1 |
| InChIKey | XCUCMLUTCAKSOZ-FIRIVFDPSA-N |
| SMILES | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)OC4=C(C=CC(=C4)CC5C6=CC(=C(C=C6CCN5C)OC)OC)O)OC |
