For research use only. Not for therapeutic Use.
Lifitegrast (Cat No.: I007669), also known as SAR-1118, is an LFA-1 antagonist primarily developed for the treatment of vascular complications of the eye. By inhibiting T cell-mediated inflammation, lifitegrast exerts its therapeutic effects by blocking the interaction between two key cell surface proteins, lymphocyte function-associated antigen 1 (LFA-1) and intercellular adhesion molecule 1 (ICAM-1). This interaction plays a crucial role in the recruitment and activation of inflammatory cells. By disrupting this interaction, lifitegrast reduces overall inflammatory responses and holds potential for managing ocular conditions associated with vascular complications.
| Catalog Number | I007669 |
| CAS Number | 1025967-78-5 |
| Synonyms | SAR-1118; SAR 1118; SAR1118; Lifitegrast, brand name: Xiidra.;(S)-2-(2-(benzofuran-6-carbonyl)-5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carboxamido)-3-(3-(methylsulfonyl)phenyl)propanoic acid |
| Molecular Formula | C₂₉H₂₄Cl₂N₂O₇S |
| Purity | 97% |
| Target | Integrin |
| Target Protein | |
| Solubility | Soluble in DMSO, not in water |
| Appearance | Solid |
| Storage | Dry, dark and at 2 - 8 °C for six months or -20°C for two years. |
| IC50 | IC50:2.98 nM |
| IUPAC Name | (2S)-2-[[2-(1-benzofuran-6-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid |
| InChI | InChI=1S/C29H24Cl2N2O7S/c1-41(38,39)20-4-2-3-16(11-20)12-23(29(36)37)32-27(34)25-22(30)13-19-15-33(9-7-21(19)26(25)31)28(35)18-6-5-17-8-10-40-24(17)14-18/h2-6,8,10-11,13-14,23H,7,9,12,15H2,1H3,(H,32,34)(H,36,37)/t23-/m0/s1 |
| InChIKey | JFOZKMSJYSPYLN-QHCPKHFHSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)C[C@@H](C(=O)O)NC(=O)C2=C(C=C3CN(CCC3=C2Cl)C(=O)C4=CC5=C(C=C4)C=CO5)Cl |
| Reference | <br /> |
