For research use only. Not for therapeutic Use.
Lignoceric acid-d9(Cat No.:S000781) is an isotopically labeled form of lignoceric acid, a saturated fatty acid found in various natural sources like animal fats and vegetable oils. The “d9” designation indicates that nine hydrogen atoms in the lignoceric acid molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling enables precise tracking of lignoceric acid metabolism and its incorporation into lipid pathways using advanced analytical techniques like mass spectrometry. Lignoceric acid-d9 serves as a valuable tool in lipid metabolism studies, aiding in elucidating pathways and understanding the role of fatty acids in cellular physiology.
CAS Number | 2415226-90-1 |
Molecular Formula | C24H39D9O2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | 21,21,22,22,23,23,24,24,24-nonadeuteriotetracosanoic acid |
InChI | InChI=1S/C24H48O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26/h2-23H2,1H3,(H,25,26)/i1D3,2D2,3D2,4D2 |
InChIKey | QZZGJDVWLFXDLK-YNSOAAEFSA-N |
SMILES | CCCCCCCCCCCCCCCCCCCCCCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |