For research use only. Not for therapeutic Use.
Ligustilide (CAT: I003569) is a bioactive compound commonly found in certain medicinal plants, such as Angelica sinensis (also known as Dong Quai). It exhibits various pharmacological actions, including anti-inflammatory, neuroprotective, and antioxidant properties. Ligustilide is known for its ability to modulate multiple molecular targets, including ion channels, receptors, and signaling pathways. It has shown potential as a therapeutic agent for conditions like cardiovascular diseases, neurodegenerative disorders, and menstrual disorders. Additionally, ligustilide is being explored for its potential applications in drug development, particularly in the field of natural products-based medicine.
| Catalog Number | I003569 |
| CAS Number | 4431-01-0 |
| Synonyms | (Z)-Ligustilide; Z-ligustilide; Cis-ligustilide; Ligustilide A |
| Molecular Formula | C12H14O2 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | RT |
| IUPAC Name | (3Z)-3-butylidene-4,5-dihydro-2-benzofuran-1-one |
| InChI | InChI=1S/C12H14O2/c1-2-3-8-11-9-6-4-5-7-10(9)12(13)14-11/h5,7-8H,2-4,6H2,1H3/b11-8- |
| InChIKey | IQVQXVFMNOFTMU-FLIBITNWSA-N |
| SMILES | CCCC=C1C2=C(C=CCC2)C(=O)O1 |
