For research use only. Not for therapeutic Use.
Ligustrazine hydrochloride (Cat.No:L003357) is a significant pharmaceutical compound with potential cardiovascular benefits. Derived from traditional Chinese medicine, it shows promise in treating ischemic conditions. Its unique properties make it a subject of interest in modern pharmacological research.
CAS Number | 126400-81-5 |
Molecular Formula | C8H13ClN2 |
Purity | ≥95% |
IUPAC Name | 2,3,5,6-tetramethylpyrazine;hydrochloride |
InChI | InChI=1S/C8H12N2.ClH/c1-5-6(2)10-8(4)7(3)9-5;/h1-4H3;1H |
InChIKey | RQKFOGXUTRDQPB-UHFFFAOYSA-N |
SMILES | CC1=C(N=C(C(=N1)C)C)C.Cl |