For research use only. Not for therapeutic Use.
Lincomycin HCl(Cat No.:A000263)is an antibiotic from the lincosamide class, effective primarily against Gram-positive bacteria, including Staphylococcus and Streptococcus species. It works by inhibiting bacterial protein synthesis through binding to the 50S ribosomal subunit, which halts cell growth and reproduction. Commonly used for treating infections such as skin infections, respiratory tract infections, and bone infections, lincomycin is administered orally or intravenously in clinical settings. Its hydrochloride form enhances solubility, making it suitable for injectable use, especially in cases where penicillin alternatives are needed.
Catalog Number | A000263 |
CAS Number | 859-18-7 |
Synonyms | NSC 70731 |
Molecular Formula | C18H34N2O6S.HCl |
Purity | ≥95% |
Target | Bacterial |
Storage | 3 years -20C powder |
IUPAC Name | (2S,4R)-N-[(1R,2R)-2-hydroxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide;hydrochloride |
InChI | InChI=1S/C18H34N2O6S.ClH/c1-5-6-10-7-11(20(3)8-10)17(25)19-12(9(2)21)16-14(23)13(22)15(24)18(26-16)27-4;/h9-16,18,21-24H,5-8H2,1-4H3,(H,19,25);1H/t9-,10-,11+,12-,13+,14-,15-,16-,18-;/m1./s1 |
InChIKey | POUMFISTNHIPTI-BOMBIWCESA-N |
SMILES | CCC[C@@H]1C[C@H](N(C1)C)C(=O)N[C@@H]([C@@H]2[C@@H]([C@@H]([C@H]([C@H](O2)SC)O)O)O)[C@@H](C)O.Cl |