For research use only. Not for therapeutic Use.
Linderalactone (CAT: R072594) is a natural bioactive compound found in certain medicinal plants, notably in the roots of Lindera aggregata and Lindera strychnifolia. This compound has attracted interest due to its potential pharmacological properties. Its specific action targets, mode of action, and pharmacologic actions have not been explicitly mentioned in the provided data. However, as a natural product, Linderalactone may have diverse biological activities that warrant further investigation.
| Catalog Number | R072594 |
| CAS Number | 728-61-0 |
| Molecular Formula | C15H16O3 |
| Purity | ≥95% |
| Target | Apoptosis |
| InChI | InChI=1S/C15H16O3/c1-9-4-3-5-11-7-13(18-15(11)16)14-10(2)8-17-12(14)6-9/h4,7-8,13H,3,5-6H2,1-2H3/b9-4+/t13-/m1/s1 |
| InChIKey | LWCKQMHMTSRRAA-QGQQYVBWSA-N |
| SMILES | CC1=CCCC2=CC(C3=C(C1)OC=C3C)OC2=O |
