For research use only. Not for therapeutic Use.
Linderane, isolated from the root of Lindera aggregata, is an irreversible inhibitor cytochrome P450 2C9 (CYP2C9). Linderane has the potential to relieve pain and cramp[1].
| Catalog Number | M056118 |
| CAS Number | 13476-25-0 |
| Synonyms | (4E,12S,13R)-5,10-dimethyl-8,14,16-trioxatetracyclo[10.2.2.01,13.07,11]hexadeca-4,7(11),9-trien-15-one |
| Molecular Formula | C15H16O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C15H16O4/c1-8-4-3-5-15-13(19-15)12(18-14(15)16)11-9(2)7-17-10(11)6-8/h4,7,12-13H,3,5-6H2,1-2H3/b8-4+/t12-,13+,15?/m0/s1 |
| InChIKey | KBMSVODXFLAQNJ-WDIVDLRRSA-N |
| SMILES | CC1=CCCC23C(O2)C(C4=C(C1)OC=C4C)OC3=O |
| Reference | [1]. Wang H, et al. Mechanism-based inactivation of CYP2C9 by linderane. Xenobiotica. 2015;45(12):1037-46. |
