For research use only. Not for therapeutic Use.
Lipid 10(Cat No.:I041186)is an experimental lipid-based compound under investigation for its potential use in drug delivery systems and therapeutic applications. It is designed to enhance the stability, bioavailability, and cellular uptake of various drugs, particularly those with low solubility. Lipid 10 is being explored in the context of targeted therapies, where it may help deliver drugs directly to specific tissues or cells, improving treatment efficacy while minimizing side effects. Ongoing research is focused on its role in optimizing drug delivery in the treatment of cancer, neurological disorders, and other conditions.
CAS Number | 2430034-02-7 |
Synonyms | 2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyl 3-(4-methylpiperazin-1-yl)propanoate |
Molecular Formula | C46H85N3O2 |
Purity | ≥95% |
IUPAC Name | 2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyl 3-(4-methylpiperazin-1-yl)propanoate |
InChI | InChI=1S/C46H85N3O2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-37-48(44-45-51-46(50)36-39-49-42-40-47(3)41-43-49)38-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21H,4-11,16-17,22-45H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
InChIKey | OVVLEZAQIGEEPO-QYCRHRGJSA-N |
SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCOC(=O)CCN1CCN(CC1)C)CCCCCCCC/C=C\C/C=C\CCCCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |