For research use only. Not for therapeutic Use.
Lipid 14（Cat No.:I041165）is a synthetic compound involved in various biomedical research areas. It functions as an important molecular mediator in inflammation and immune responses. Typically used in studies related to cell signaling, Lipid 14 has shown potential as a modulator of immune cell activation, offering insights into inflammatory diseases. Researchers are investigating its role in modulating pathways linked to immune system regulation, with possible therapeutic implications in treating inflammatory disorders and autoimmune diseases. Further studies are needed to explore its efficacy and safety in clinical applications.
| CAS Number | 2430034-05-0 |
| Synonyms | 8-[2-[4-(dimethylamino)butanoyloxy]ethyl-[8-(2-hexyldecanoyloxy)octyl]amino]octyl 2-hexyldecanoate |
| Molecular Formula | C56H110N2O6 |
| Purity | ≥95% |
| IUPAC Name | 8-[2-[4-(dimethylamino)butanoyloxy]ethyl-[8-(2-hexyldecanoyloxy)octyl]amino]octyl 2-hexyldecanoate |
| InChI | InChI=1S/C56H110N2O6/c1-7-11-15-19-25-33-42-52(40-31-17-13-9-3)55(60)63-49-37-29-23-21-27-35-46-58(48-51-62-54(59)44-39-45-57(5)6)47-36-28-22-24-30-38-50-64-56(61)53(41-32-18-14-10-4)43-34-26-20-16-12-8-2/h52-53H,7-51H2,1-6H3 |
| InChIKey | NGUVKPMCPAGUDU-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCCCN(CCCCCCCCOC(=O)C(CCCCCC)CCCCCCCC)CCOC(=O)CCCN(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
