For research use only. Not for therapeutic Use.
Lipid 8（Cat No.:I041185）is an investigational lipid compound being studied for its potential in drug delivery and therapeutic applications. It is designed to improve the stability and bioavailability of various therapeutic agents, particularly those with low solubility or poor permeability. Lipid 8 is being explored for its ability to enhance the efficiency of lipid nanoparticle-based drug delivery systems, allowing for targeted delivery of drugs to specific tissues or cells. This could improve the therapeutic effects and reduce side effects, with ongoing research evaluating its potential in cancer, gene therapy, and other areas.
| CAS Number | 2226547-25-5 |
| Synonyms | 2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyl 4-(dimethylamino)butanoate |
| Molecular Formula | C44H82N2O2 |
| Purity | ≥95% |
| IUPAC Name | 2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyl 4-(dimethylamino)butanoate |
| InChI | InChI=1S/C44H82N2O2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40-46(42-43-48-44(47)38-37-39-45(3)4)41-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22H,5-12,17-18,23-43H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | VXHLVEWQGUIWMM-KWXKLSQISA-N |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCOC(=O)CCCN(C)C)CCCCCCCC/C=C\C/C=C\CCCCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
