For research use only. Not for therapeutic Use.
Lipoamide (CAT: I005589), also known as dihydrolipoamide or thioctic acid, is a compound with a vital role in cellular metabolism. It functions as a cofactor in several enzyme complexes, including the pyruvate dehydrogenase complex and the alpha-ketoglutarate dehydrogenase complex, which are involved in energy production through the citric acid cycle. Lipoamide acts as a carrier of acetyl and other acyl groups during these enzymatic reactions, facilitating the transfer of metabolic intermediates. Additionally, lipoamide possesses antioxidant properties, helping to scavenge free radicals and protect cells from oxidative damage. It is also a precursor for the synthesis of the potent antioxidant alpha-lipoic acid.
| Catalog Number | I005589 |
| CAS Number | 940-69-2 |
| Synonyms | α-Lipamide; (±)-1,2-Dithiolane-3-pentanamide; Pathoclon; |
| Molecular Formula | C8H15NOS2 |
| Purity | ≥95% |
| Target | NO Synthase |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20C powder |
| Related CAS | 3206-73-3 |
| InChI | InChI=1S/C8H15NOS2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H2,9,10) |
| InChIKey | FCCDDURTIIUXBY-UHFFFAOYSA-N |
| SMILES | C1CSSC1CCCCC(=O)N |
