For research use only. Not for therapeutic Use.
Lipoxamycin(Cat No.:M063815)is a potent bioactive compound known for its inhibitory effects on the 5-lipoxygenase (5-LOX) enzyme, a key enzyme involved in the biosynthesis of pro-inflammatory leukotrienes. By selectively targeting 5-LOX, Lipoxamycin plays a significant role in modulating inflammatory responses, making it a promising candidate for therapeutic applications in diseases characterized by chronic inflammation, such as asthma, rheumatoid arthritis, and inflammatory bowel disease. Its potential as a lead compound for the development of novel anti-inflammatory drugs highlights its relevance in biomedical research and drug discovery.
CAS Number | 11075-87-9 |
Synonyms | Lipoxamycin |
Molecular Formula | C38H74N4O14S |
Purity | ≥95% |
Target | Fungal |
Storage | Store at +4C |
IUPAC Name | (2S)-2-amino-N,3-dihydroxy-N-(14-methyl-3,10-dioxopentadecyl)propanamide;sulfuric acid |
InChI | InChI=1S/2C19H36N2O5.H2O4S/c2*1-15(2)8-7-11-16(23)9-5-3-4-6-10-17(24)12-13-21(26)19(25)18(20)14-22;1-5(2,3)4/h2*15,18,22,26H,3-14,20H2,1-2H3;(H2,1,2,3,4)/t2*18-;/m00./s1 |
InChIKey | LQVOFMWEPHCSIY-IJBYHFJWSA-N |
SMILES | CC(C)CCCC(=O)CCCCCCC(=O)CCN(C(=O)[C@H](CO)N)O.CC(C)CCCC(=O)CCCCCCC(=O)CCN(C(=O)[C@H](CO)N)O.OS(=O)(=O)O |