For research use only. Not for therapeutic Use.
Liranaftate（Cat No.:A001127）is a potent antifungal compound used primarily in the treatment of dermatophyte infections, such as athlete’s foot, jock itch, and ringworm. It inhibits the synthesis of ergosterol, a vital component of fungal cell membranes, disrupting the cell’s integrity and leading to cell death. Liranaftate exhibits broad-spectrum antifungal activity against a range of dermatophytes and is often formulated in topical applications, providing effective relief from fungal skin infections. Its use is well-tolerated, with minimal systemic absorption, making it a preferred option for localized treatment in dermatological care.
| Catalog Number | A001127 |
| CAS Number | 88678-31-3 |
| Synonyms | M-732 |
| Molecular Formula | C18H20N2O2S |
| Purity | ≥95% |
| Target | Fungal |
| Storage | 3 years -20C powder |
| IUPAC Name | O-(5,6,7,8-tetrahydronaphthalen-2-yl) N-(6-methoxypyridin-2-yl)-N-methylcarbamothioate |
| InChI | InChI=1S/C18H20N2O2S/c1-20(16-8-5-9-17(19-16)21-2)18(23)22-15-11-10-13-6-3-4-7-14(13)12-15/h5,8-12H,3-4,6-7H2,1-2H3 |
| InChIKey | VPHPQNGOVQYUMG-UHFFFAOYSA-N |
| SMILES | CN(C1=NC(=CC=C1)OC)C(=S)OC2=CC3=C(CCCC3)C=C2 |
