For research use only. Not for therapeutic Use.
Liriodenine Methiodide(CAT: I030858) is a plant-derived alkaloid and a quaternary ammonium salt known for its diverse pharmacological activities. It exhibits potent antimicrobial, antifungal, and anticancer properties, making it a valuable compound in medicinal chemistry and pharmacology research. Liriodenine Methiodide acts by intercalating into DNA, thereby inhibiting DNA and RNA synthesis, which contributes to its cytotoxic effects against cancer cells. Additionally, it has been studied for its role in modulating oxidative stress and mitochondrial pathways. Liriodenine Methiodide is a critical tool for exploring natural product-based drug development and understanding the molecular mechanisms of its bioactivities.
CAS Number | 55974-07-7 |
Synonyms | Liriodenine methiodide; |
Molecular Formula | C18H12INO3 |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | 7-methyl-8-oxo-8H-[1,3]dioxolo[4',5':4,5]benzo[1,2,3-de]benzo[g]quinolin-7-ium iodide |
InChI | InChI=1S/C18H12NO3.HI/c1-19-7-6-10-8-13-18(22-9-21-13)15-11-4-2-3-5-12(11)17(20)16(19)14(10)15;/h2-8H,9H2,1H3;1H/q+1;/p-1 |
InChIKey | CCESGQSVLLZXKI-UHFFFAOYSA-M |
SMILES | O=C1C2=CC=CC=C2C3=C4C(C=C[N+](C)=C14)=CC5=C3OCO5.[I-] |