For research use only. Not for therapeutic Use.
Liriodenine is a naturally occurring alkaloid found in various plant species, used in pharmaceutical and biochemical research. Known for its potential anticancer, antimicrobial, and antifungal properties, it is essential for studying the pharmacological activities of natural compounds. This compound aids in the development of novel therapeutic agents, ensuring precise and reliable results in advanced drug discovery and medicinal chemistry research.
| Catalog Number | R014726 |
| CAS Number | 475-75-2 |
| Molecular Formula | C17H9NO3 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| InChI | InChI=1S/C17H9NO3/c19-16-11-4-2-1-3-10(11)14-13-9(5-6-18-15(13)16)7-12-17(14)21-8-20-12/h1-7H,8H2 |
| InChIKey | MUMCCPUVOAUBAN-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
