For research use only. Not for therapeutic Use.
Lisavanbulin（Cat No.:I000866） is an investigational anticancer drug targeting microtubule dynamics. It specifically inhibits the microtubule-associated protein, disrupting microtubule assembly and leading to cell cycle arrest and apoptosis in cancer cells. Lisavanbulin shows promise in treating various cancers, including glioblastoma, due to its ability to cross the blood-brain barrier. Its targeted mechanism enhances the efficacy against tumor cells while minimizing damage to normal cells. As a novel therapeutic agent, Lisavanbulin holds potential for improving outcomes in patients with hard-to-treat cancers, particularly those in the central nervous system.
| Catalog Number | I000866 |
| CAS Number | 1263384-43-5 |
| Molecular Formula | C26H29N9O3 |
| Purity | ≥95% |
| Target | microtublin inhibitor |
| IUPAC Name | (2S)-2,6-diamino-N-[4-[2-[2-[4-(2-cyanoethylamino)-1,2,5-oxadiazol-3-yl]benzimidazol-1-yl]acetyl]phenyl]hexanamide |
| InChI | InChI=1S/C26H29N9O3/c27-13-4-3-6-19(29)26(37)31-18-11-9-17(10-12-18)22(36)16-35-21-8-2-1-7-20(21)32-25(35)23-24(34-38-33-23)30-15-5-14-28/h1-2,7-12,19H,3-6,13,15-16,27,29H2,(H,30,34)(H,31,37)/t19-/m0/s1 |
| InChIKey | NIPZLALJRAHABJ-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N2CC(=O)C3=CC=C(C=C3)NC(=O)C(CCCCN)N)C4=NON=C4NCCC#N |
