For research use only. Not for therapeutic Use.
Lithium Propyl Phosphate (Cat. No: R024881) is an organic reagent, mainly used as a pharmaceutical organic intermediate for drug preparation and research and development in the pharmaceutical and chemical industry, and can be used for the preparation of thiourea pyrimidine derivatives.
| CAS Number | 4656-39-7 |
| Synonyms | Propyl Lithium Phosphate, (PrO)(LiO)2PO; Phosphoric Acid, Monopropyl Ester, Dilithium Salt |
| Molecular Formula | C3H7Li2O4P |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | dilithium;propyl phosphate |
| InChI | InChI=1S/C3H9O4P.2Li/c1-2-3-7-8(4,5)6;;/h2-3H2,1H3,(H2,4,5,6);;/q;2*+1/p-2 |
| InChIKey | PXHZVPMXWNTBKG-UHFFFAOYSA-L |
| SMILES | [Li+].[Li+].CCCOP(=O)([O-])[O-] |
