For research use only. Not for therapeutic Use.
Lithium triisopropoxy(thiazol-2-yl)borate is an organoboron compound featuring a lithium ion coordinated with triisopropoxy groups and a thiazole moiety. This compound is significant in organic synthesis, particularly in the formation of boron-containing intermediates and in various coupling reactions. Its unique structure enhances reactivity, making it valuable for applications in materials science and catalysis. Additionally, the thiazole group may impart specific biological activities, making this compound of interest in medicinal chemistry for developing novel therapeutic agents.
CAS Number | 1393823-02-3 |
Molecular Formula | C12H23BLiNO3S |
Purity | ≥95% |
IUPAC Name | lithium;tri(propan-2-yloxy)-(1,3-thiazol-2-yl)boranuide |
InChI | InChI=1S/C12H23BNO3S.Li/c1-9(2)15-13(16-10(3)4,17-11(5)6)12-14-7-8-18-12;/h7-11H,1-6H3;/q-1;+1 |
InChIKey | XGZVFXHXFXYOQK-UHFFFAOYSA-N |
SMILES | [Li+].[B-](C1=NC=CS1)(OC(C)C)(OC(C)C)OC(C)C |