For research use only. Not for therapeutic Use.
Lithocholic Acid (LCA)(CAT: I003548) is a secondary bile acid produced by gut microbiota through the metabolism of primary bile acids. It is widely used in gastrointestinal, metabolic, and cancer research due to its role in bile acid signaling, cholesterol metabolism, and cellular regulation. As a ligand for nuclear receptors such as FXR and VDR, LCA influences gene expression related to bile acid synthesis and detoxification. It exhibits dual effects, promoting cytoprotection in certain contexts while inducing cytotoxicity through DNA damage and apoptosis. Lithocholic Acid is essential for studying bile acid physiology, microbiota interactions, and therapeutic strategies for metabolic and liver diseases.
| Catalog Number | I003548 |
| CAS Number | 434-13-9 |
| Synonyms | 3ɑ-Hydroxy Cholanic Acid;LCA;Lithocholate;NSC 683770 |
| Molecular Formula | C24H40O3 |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | DMSO 75 mg/mL; Water <1 mg/mL; Ethanol 49 mg/mL |
| Storage | -20℃ |
| IUPAC Name | (4R)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| InChI | InChI=1S/C24H40O3/c1-15(4-9-22(26)27)19-7-8-20-18-6-5-16-14-17(25)10-12-23(16,2)21(18)11-13-24(19,20)3/h15-21,25H,4-14H2,1-3H3,(H,26,27)/t15-,16-,17-,18+,19-,20+,21+,23+,24-/m1/s1 |
| InChIKey | SMEROWZSTRWXGI-HVATVPOCSA-N |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)C |
